2-Phenoxyacetic anhydride
Phenoxyacetic Anhydride
CAS: 14316-61-1
Molecular Formula: C16H14O5
2-Phenoxyacetic anhydride - Names and Identifiers
| Name | Phenoxyacetic Anhydride |
| Synonyms | Phenoxyacetic Anhydride PHENOXYACETIC ANHYDRIDE 2-Phenoxyacetic anhydride Bis(phenoxyacetic)anhydride PHENOXYACETIC ANHYDRIDE (14316-61-1) Acetic acid, 2-phenoxy-, 1,1'-anhydride |
| CAS | 14316-61-1 |
| InChI | InChI=1/C16H14O5/c17-15(11-19-13-7-3-1-4-8-13)21-16(18)12-20-14-9-5-2-6-10-14/h1-10H,11-12H2 |
2-Phenoxyacetic anhydride - Physico-chemical Properties
| Molecular Formula | C16H14O5 |
| Molar Mass | 286.28 |
| Density | 1.234g/cm3 |
| Melting Point | 70-74°C |
| Boling Point | 427.8°C at 760 mmHg |
| Flash Point | 190°C |
| Vapor Presure | 1.59E-07mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Almost white |
| Storage Condition | Store at RT. |
| Refractive Index | 1.558 |
| MDL | MFCD00059681 |
2-Phenoxyacetic anhydride - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10-21 |
2-Phenoxyacetic anhydride - Introduction
Phenoxyacetic anhydride is an organic compound with the molecular formula C10H10O3 and the structural formula PhOOCCH3.
Its properties are as follows:
1. Appearance: White crystalline solid.
2. Melting point: 37-39°C.
3. Boiling point: 249-251°C.
4. solubility: soluble in commonly used organic solvents, such as ethanol, chloroform and dichloromethane, slightly soluble in water.
The main uses of phenoxyacetic anhydride include:
1. Organic synthesis: As a reagent for esterification reaction, it is used to synthesize various ester compounds.
2. Cosmetics: As one of the raw materials of spices and flavors, it is used to prepare perfumes, cosmetics, etc.
3. pharmaceutical field: can be used for the synthesis of certain drug intermediates.
Phenoxyacetic anhydride is generally obtained by the following preparation method:
p-hydroxybenzoic acid and acetic acid are reacted to generate phenoxy acetate by esterification reaction, and then phenoxy acetic anhydride is obtained by esterification and acidification.
Note the following safety information when using phenoxyacetic anhydride:
1. Wear appropriate personal protective equipment, such as chemical protective gloves and goggles, to avoid contact with skin and eyes.
2. avoid inhalation of its vapor, should provide good ventilation environment.
3. should be stored away from the fire and heat sources, avoid contact with the oxidant.
4. Pay attention to prevent leakage and impact during handling and storage.
Its properties are as follows:
1. Appearance: White crystalline solid.
2. Melting point: 37-39°C.
3. Boiling point: 249-251°C.
4. solubility: soluble in commonly used organic solvents, such as ethanol, chloroform and dichloromethane, slightly soluble in water.
The main uses of phenoxyacetic anhydride include:
1. Organic synthesis: As a reagent for esterification reaction, it is used to synthesize various ester compounds.
2. Cosmetics: As one of the raw materials of spices and flavors, it is used to prepare perfumes, cosmetics, etc.
3. pharmaceutical field: can be used for the synthesis of certain drug intermediates.
Phenoxyacetic anhydride is generally obtained by the following preparation method:
p-hydroxybenzoic acid and acetic acid are reacted to generate phenoxy acetate by esterification reaction, and then phenoxy acetic anhydride is obtained by esterification and acidification.
Note the following safety information when using phenoxyacetic anhydride:
1. Wear appropriate personal protective equipment, such as chemical protective gloves and goggles, to avoid contact with skin and eyes.
2. avoid inhalation of its vapor, should provide good ventilation environment.
3. should be stored away from the fire and heat sources, avoid contact with the oxidant.
4. Pay attention to prevent leakage and impact during handling and storage.
Last Update：2024-04-09 19:05:46
Supplier List
Spot supply
Product Name: Phenoxyacetic Anhydride Request for quotationCAS: 14316-61-1
Tel: +86-17551318830
Email: r@reformchem.com
Mobile: +86-17551318830
QQ: 3787852685
Spot supply
Product Name: Phenoxyacetic Anhydride Request for quotationCAS: 14316-61-1
Tel: +86-17551318830
Email: r@reformchem.com
Mobile: +86-17551318830
QQ: 3785839865
Spot supply
Product Name: 2-Phenoxyacetic anhydride Visit Supplier Webpage Request for quotationCAS: 14316-61-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Spot supply
Product Name: Phenoxyacetic Anhydride Request for quotationCAS: 14316-61-1
Tel: +86-17551318830
Email: r@reformchem.com
Mobile: +86-17551318830
QQ: 3787852685
Spot supply
Product Name: Phenoxyacetic Anhydride Request for quotationCAS: 14316-61-1
Tel: +86-17551318830
Email: r@reformchem.com
Mobile: +86-17551318830
QQ: 3785839865
Spot supply
Product Name: 2-Phenoxyacetic anhydride Visit Supplier Webpage Request for quotationCAS: 14316-61-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History